2-Hydroxy Nevirapine
2-Hydroxy Nevirapine is a structurally related impurity of the antiretroviral drug Nevirapine, characterized by the introduction of a hydroxyl group at the 2-position of the pyridine ring. This substitution replaces a hydrogen atom, introducing a polar hydroxyl functionality that alters the compound's electronic distribution and hydrogen bonding capacity compared to the parent molecule. The core structure retains the 2-chloro-5-(trifluoromethyl)pyridine-3-ylmethyl moiety fused to a pyrimidine ring, with an ethyl group at position 4. The hydroxyl substitution enhances polarity, potentially affecting solubility and chromatographic behavior. This compound serves as a critical HPLC reference standard for quantifying process-related impurities in Nevirapine drug substance synthesis.
On Request📝 Synonyms
🔬 Chemical Identifiers
CC1=CC(=O)NC2=C1NC(=O)C3=C(N2C4CC4)N=CC=C3
InChI=1S/C15H14N4O2/c1-8-7-11(20)17-14-12(8)18-15(21)10-3-2-6-16-13(10)19(14)9-4-5-9/h2-3,6-7,9H,4-5H2,1H3,(H,17,20)(H,18,21)
LFZSOJABLBVGRJ-UHFFFAOYSA-N
