Amlodipine EP Impurity C is a chloro-substituted dihydropyridine derivative featuring a pyridine ring fused to a partially hydrogenated 1,4-dihydropyridine core, with a methyl ester functionality and a 2-methoxyphenyl substituent. The compound retains the parent drug's aminopropyl side chain but incorporates a chlorine atom at the 4-position of the dihydropyridine ring, distinguishing it from amlodipine. This structural modification arises from a side reaction during synthetic amination steps, leading to chlorinated byproducts. The impurity serves as a critical HPLC reference standard for quantifying process-related impurities in amlodipine bulk drug substance.
On Request| Std | Catalog # | Quantity | Price |
|---|---|---|---|
| USP | 1A10910 ↗ | 25 mg | USD 550.00 |
CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2Cl)C(=O)OC)COCCN)COCCN
InChI=1S/C22H30ClN3O6/c1-3-32-22(28)20-17(13-31-11-9-25)26-16(12-30-10-8-24)19(21(27)29-2)18(20)14-6-4-5-7-15(14)23/h4-7,18,26H,3,8-13,24-25H2,1-2H3
BHRYCUURXPBYOM-UHFFFAOYSA-N