Bromfenac Methyl Ester (C16H14BrNO3, CAS: 2445168-29-4) is an ester derivative of Bromfenac, a potent NSAID used for ocular inflammation. As an API impurity, it typically forms during the manufacturing process of Bromfenac, potentially via esterification with methanol-containing solvents or as a degradation product under certain conditions. Characterization and quantification of this impurity are crucial for ensuring the purity, safety, and efficacy of the final Bromfenac drug product, adhering to strict pharmaceutical regulatory standards.
On RequestNC1=C(C=CC=C1C(C1=CC=C(C=C1)Br)=O)CC(=O)OC
InChI=1S/C16H14BrNO3/c1-21-14(19)9-11-3-2-4-13(15(11)18)16(20)10-5-7-12(17)8-6-10/h2-8H,9,18H2,1H3
RTFZGDZYUBFGKT-UHFFFAOYSA-N