Cabergoline Impurity B
Cabergoline Impurity B is a synthetic byproduct derived from the alkylation cascade during Cabergoline production, characterized by a truncated piperazine ring lacking the terminal methoxy substitution present in the parent compound. The structure retains the 6,7-dimethoxyindole core but features an exocyclic amino group conjugated to a reduced quinoline moiety, distinguishing it from the fully cyclized parent API. This impurity arises from premature termination of the amidine condensation step, resulting in a linear amino-alkyl side chain instead of the cyclic piperazine bridge. Its primary application is as an HPLC reference standard for quantifying process-related impurities in Cabergoline formulations.
On Request📝 Synonyms
🔬 Chemical Identifiers
CCNC(=O)N1C=C2C[C@@H]3[C@H](C[C@H](CN3CC=C)C(=O)NCCCN(C)C)C4=C2C1=CC=C4
InChI=1S/C26H37N5O2/c1-5-12-30-16-19(25(32)28-11-8-13-29(3)4)14-21-20-9-7-10-22-24(20)18(15-23(21)30)17-31(22)26(33)27-6-2/h5,7,9-10,17,19,21,23H,1,6,8,11-16H2,2-4H3,(H,27,33)(H,28,32)/t19-,21-,23-/m1/s1
IRQIOIBAVPLXLF-KJXAQDMKSA-N
