Ibuprofen Impurity M
Ibuprofen Impurity M, chemically identified as (RS)-2-[4-(2-hydroxy-2-methylpropyl)phenyl]propanoic acid, is a hydroxylated derivative of the non-steroidal anti-inflammatory drug ibuprofen. Structurally, it retains the propanoic acid moiety and the para-substituted phenyl ring characteristic of the parent drug. The key chemical modification lies in the isobutyl side chain, where a hydrogen atom at the tertiary carbon is replaced by a hydroxyl group. This introduces an alcohol functionality, while the carboxylic acid remains intact. Its precise application is as a high-purity reference standard for the chromatographic identification and quantification of this specific process-related impurity in ibuprofen drug substances and finished products.
On Request📝 Synonyms
🔬 Chemical Identifiers
OC(C(=O)O)(C)C1=CC=C(C=C1)CC(C)C
InChI=1S/C13H18O3/c1-9(2)8-10-4-6-11(7-5-10)13(3,16)12(14)15/h4-7,9,16H,8H2,1-3H3,(H,14,15)
APEODKDQAWQDLW-UHFFFAOYSA-N
