Nevirapine is a non-nucleoside reverse transcriptase inhibitor containing a 1H-pyrazole ring fused to a pyridine core, substituted with a terminal nitrile and a 3,5-dimethylpyrazinyl group. The molecule exhibits tautomeric equilibrium between enol and keto forms, essential for optimal binding to HIV-1 reverse transcriptase. As the parent drug, it functions as an HPLC reference standard for antiretroviral drug quantification.
On Request| Std | Catalog # | Quantity | Price |
|---|---|---|---|
| EP | Y0000520 ↗ | 30 MG | EUR 90.00 |
| EP | Y0000521 ↗ | 0.058 MG | EUR 90.00 |
| USP | 1460703 ↗ | 100 mg | USD 297.00 |
CC1=C2C(=NC=C1)N(C3=C(C=CC=N3)C(=O)N2)C4CC4
InChI=1S/C15H14N4O/c1-9-6-8-17-14-12(9)18-15(20)11-3-2-7-16-13(11)19(14)10-4-5-10/h2-3,6-8,10H,4-5H2,1H3,(H,18,20)
NQDJXKOVJZTUJA-UHFFFAOYSA-N