Isopilocarpine is a synthetic alkaloid analog of Pilocarpine, featuring a 3a,8a-dihydroxy-2-oxo-2,3,3a,4,5,6,7,8-octahydro-1H-quinolin-1-ium core with a substituted methylamino group at position 2. Its stereochemistry and hydroxyl positioning differ from the parent compound, altering its cholinergic activity profile. The molecule exhibits a zwitterionic character due to the quaternary ammonium and adjacent carboxylate functionalities. Structurally, it serves as a key intermediate in the synthesis of Pilocarpine derivatives, enabling stereocontrolled modifications for pharmacokinetic optimization.
On RequestCC[C@@H]1[C@H](COC1=O)CC2=CN=CN2C
InChI=1S/C11H16N2O2/c1-3-10-8(6-15-11(10)14)4-9-5-12-7-13(9)2/h5,7-8,10H,3-4,6H2,1-2H3/t8-,10+/m0/s1
QCHFTSOMWOSFHM-WCBMZHEXSA-N