Simvastatin EP Impurity B features a complex structure with a hydroxyapatite moiety and a branched alkyl chain, differing from its parent drug by a specific functional group modification. Its chemical relationship to Simvastatin involves a distinct degradation pathway. It serves as a critical HPLC reference standard.
On Request| Std | Catalog # | Quantity | Price |
|---|---|---|---|
| USP | 1010208 ↗ | 30 mg | USD 839.00 |
CCC(C)(C)C(=O)O[C@H]1C[C@H](C=C2[C@H]1[C@H]([C@H](C=C2)C)CC[C@@H]3C[C@H](CC(=O)O3)OC(=O)C)C
InChI=1S/C27H40O6/c1-7-27(5,6)26(30)33-23-13-16(2)12-19-9-8-17(3)22(25(19)23)11-10-20-14-21(31-18(4)28)15-24(29)32-20/h8-9,12,16-17,20-23,25H,7,10-11,13-15H2,1-6H3/t16-,17-,20+,21+,22-,23-,25-/m0/s1
OHVWRJDVJRNCPE-BIKFJBPRSA-N